C14H16ClNO5S — CID 146599056
3-[3-(1,3-dioxoisoindol-2-yl)propoxy]propane-1-sulfonyl chloride (PubChem CID 146599056) has the molecular formula C14H16ClNO5S and a molecular weight of 345.80 g/mol. Its IUPAC name is 3-[3-(1,3-dioxoisoindol-2-yl)propoxy]propane-1-sulfonyl chloride.
| Compound Name | 3-[3-(1,3-dioxoisoindol-2-yl)propoxy]propane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 146599056 |
| Molecular Formula | C14H16ClNO5S |
| Molecular Weight | 345.80 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 3-[3-(1,3-dioxoisoindol-2-yl)propoxy]propane-1-sulfonyl chloride |
| SMILES | O=C1c2ccccc2C(=O)N1CCCOCCCS(=O)(=O)Cl |
| InChI | InChI=1S/C14H16ClNO5S/c15-22(19,20)10-4-9-21-8-3-7-16-13(17)11-5-1-2-6-12(11)14(16)18/h1-2,5-6H,3-4,7-10H2 |
| InChIKey | OERPTTRAMGJZDP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.80 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|