C21H23NO5S — CID 110504539
3-(1,3-dioxoisoindol-2-yl)propyl 4-tert-butylbenzenesulfonate (PubChem CID 110504539) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 4-tert-butylbenzenesulfonate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 4-tert-butylbenzenesulfonate |
|---|---|
| PubChem CID | 110504539 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 4-tert-butylbenzenesulfonate |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)OCCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H23NO5S/c1-21(2,3)15-9-11-16(12-10-15)28(25,26)27-14-6-13-22-19(23)17-7-4-5-8-18(17)20(22)24/h4-5,7-12H,6,13-14H2,1-3H3 |
| InChIKey | YWHPGHUBONMJGR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|