C23H40N2O4 — CID 158181358
methane;3-[(2-methylpropan-2-yl)oxy]propan-1-amine;2-[3-[(2-methylpropan-2-yl)oxy]propyl]isoindole-1,3-dione (PubChem CID 158181358) has the molecular formula C23H40N2O4 and a molecular weight of 408.58 g/mol. Its IUPAC name is methane;3-[(2-methylpropan-2-yl)oxy]propan-1-amine;2-[3-[(2-methylpropan-2-yl)oxy]propyl]isoindole-1,3-dione.
| Compound Name | methane;3-[(2-methylpropan-2-yl)oxy]propan-1-amine;2-[3-[(2-methylpropan-2-yl)oxy]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 158181358 |
| Molecular Formula | C23H40N2O4 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | methane;3-[(2-methylpropan-2-yl)oxy]propan-1-amine;2-[3-[(2-methylpropan-2-yl)oxy]propyl]isoindole-1,3-dione |
| SMILES | C.CC(C)(C)OCCCN.CC(C)(C)OCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H19NO3.C7H17NO.CH4/c1-15(2,3)19-10-6-9-16-13(17)11-7-4-5-8-12(11)14(16)18;1-7(2,3)9-6-4-5-8;/h4-5,7-8H,6,9-10H2,1-3H3;4-6,8H2,1-3H3;1H4 |
| InChIKey | FYQDMBFCOQJHHP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|