C42H46N2O10P2 — CID 158079735
3-aminopropyl dibenzyl phosphate;dibenzyl 3-(1,3-dioxoisoindol-2-yl)propyl phosphate (PubChem CID 158079735) has the molecular formula C42H46N2O10P2 and a molecular weight of 800.78 g/mol. Its IUPAC name is 3-aminopropyl dibenzyl phosphate;dibenzyl 3-(1,3-dioxoisoindol-2-yl)propyl phosphate.
| Compound Name | 3-aminopropyl dibenzyl phosphate;dibenzyl 3-(1,3-dioxoisoindol-2-yl)propyl phosphate |
|---|---|
| PubChem CID | 158079735 |
| Molecular Formula | C42H46N2O10P2 |
| Molecular Weight | 800.78 g/mol |
| Exact Mass | 800.26 |
| IUPAC Name | 3-aminopropyl dibenzyl phosphate;dibenzyl 3-(1,3-dioxoisoindol-2-yl)propyl phosphate |
| SMILES | NCCCOP(=O)(OCc1ccccc1)OCc1ccccc1.O=C1c2ccccc2C(=O)N1CCCOP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C25H24NO6P.C17H22NO4P/c27-24-22-14-7-8-15-23(22)25(28)26(24)16-9-17-30-33(29,31-18-20-10-3-1-4-11-20)32-19-21-12-5-2-6-13-21;18-12-7-13-20-23(19,21-14-16-8-3-1-4-9-16)22-15-17-10-5-2-6-11-17/h1-8,10-15H,9,16-19H2;1-6,8-11H,7,12-15,18H2 |
| InChIKey | FMUOUHCKPOUPMO-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 152.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.78 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|