C26H47N3O4 — CID 165099348
4-methylpentan-1-amine;3-propan-2-yloxypropan-1-amine;2-(3-propan-2-yloxypropyl)isoindole-1,3-dione (PubChem CID 165099348) has the molecular formula C26H47N3O4 and a molecular weight of 465.68 g/mol. Its IUPAC name is 4-methylpentan-1-amine;3-propan-2-yloxypropan-1-amine;2-(3-propan-2-yloxypropyl)isoindole-1,3-dione.
| Compound Name | 4-methylpentan-1-amine;3-propan-2-yloxypropan-1-amine;2-(3-propan-2-yloxypropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 165099348 |
| Molecular Formula | C26H47N3O4 |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.36 |
| IUPAC Name | 4-methylpentan-1-amine;3-propan-2-yloxypropan-1-amine;2-(3-propan-2-yloxypropyl)isoindole-1,3-dione |
| SMILES | CC(C)CCCN.CC(C)OCCCN.CC(C)OCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H17NO3.C6H15NO.C6H15N/c1-10(2)18-9-5-8-15-13(16)11-6-3-4-7-12(11)14(15)17;1-6(2)8-5-3-4-7;1-6(2)4-3-5-7/h3-4,6-7,10H,5,8-9H2,1-2H3;6H,3-5,7H2,1-2H3;6H,3-5,7H2,1-2H3 |
| InChIKey | YBEHRBVMWGYOFK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|