C25H41NO8P2 — CID 139615917
2-[4,4-bis[di(propan-2-yloxy)phosphoryl]pentyl]isoindole-1,3-dione (PubChem CID 139615917) has the molecular formula C25H41NO8P2 and a molecular weight of 545.55 g/mol. Its IUPAC name is 2-[4,4-bis[di(propan-2-yloxy)phosphoryl]pentyl]isoindole-1,3-dione.
| Compound Name | 2-[4,4-bis[di(propan-2-yloxy)phosphoryl]pentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139615917 |
| Molecular Formula | C25H41NO8P2 |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | 2-[4,4-bis[di(propan-2-yloxy)phosphoryl]pentyl]isoindole-1,3-dione |
| SMILES | CC(C)OP(=O)(OC(C)C)C(C)(CCCN1C(=O)c2ccccc2C1=O)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C25H41NO8P2/c1-17(2)31-35(29,32-18(3)4)25(9,36(30,33-19(5)6)34-20(7)8)15-12-16-26-23(27)21-13-10-11-14-22(21)24(26)28/h10-11,13-14,17-20H,12,15-16H2,1-9H3 |
| InChIKey | XYVQQGSDKIWGQM-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|