C18H25NO3 — CID 132513364
2-(7-hydroxy-3,7-dimethyloctyl)isoindole-1,3-dione (PubChem CID 132513364) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 2-(7-hydroxy-3,7-dimethyloctyl)isoindole-1,3-dione.
| Compound Name | 2-(7-hydroxy-3,7-dimethyloctyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 132513364 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-(7-hydroxy-3,7-dimethyloctyl)isoindole-1,3-dione |
| SMILES | CC(CCCC(C)(C)O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H25NO3/c1-13(7-6-11-18(2,3)22)10-12-19-16(20)14-8-4-5-9-15(14)17(19)21/h4-5,8-9,13,22H,6-7,10-12H2,1-3H3 |
| InChIKey | TWCJGZVHMZLJTF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|