C23H25NO5 — CID 10763243
benzyl (2S)-2-(1,3-dioxoisoindol-2-yl)-6-hydroxy-6-methylheptanoate (PubChem CID 10763243) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is benzyl (2S)-2-(1,3-dioxoisoindol-2-yl)-6-hydroxy-6-methylheptanoate.
| Compound Name | benzyl (2S)-2-(1,3-dioxoisoindol-2-yl)-6-hydroxy-6-methylheptanoate |
|---|---|
| PubChem CID | 10763243 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | benzyl (2S)-2-(1,3-dioxoisoindol-2-yl)-6-hydroxy-6-methylheptanoate |
| SMILES | CC(C)(O)CCC[C@@H](C(=O)OCc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H25NO5/c1-23(2,28)14-8-13-19(22(27)29-15-16-9-4-3-5-10-16)24-20(25)17-11-6-7-12-18(17)21(24)26/h3-7,9-12,19,28H,8,13-15H2,1-2H3/t19-/m0/s1 |
| InChIKey | RRXBGCWNKZXWNP-IBGZPJMESA-N |
| XLogP | 3.34 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|