C24H25NO5 — CID 11101593
benzyl (2S)-2-(1,3-dioxoisoindol-2-yl)-6-hydroxynon-8-enoate (PubChem CID 11101593) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is benzyl (2S)-2-(1,3-dioxoisoindol-2-yl)-6-hydroxynon-8-enoate.
| Compound Name | benzyl (2S)-2-(1,3-dioxoisoindol-2-yl)-6-hydroxynon-8-enoate |
|---|---|
| PubChem CID | 11101593 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | benzyl (2S)-2-(1,3-dioxoisoindol-2-yl)-6-hydroxynon-8-enoate |
| SMILES | C=CCC(O)CCC[C@@H](C(=O)OCc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H25NO5/c1-2-9-18(26)12-8-15-21(24(29)30-16-17-10-4-3-5-11-17)25-22(27)19-13-6-7-14-20(19)23(25)28/h2-7,10-11,13-14,18,21,26H,1,8-9,12,15-16H2/t18?,21-/m0/s1 |
| InChIKey | ORDVIGQTKHGAMF-ZYZRXSCRSA-N |
| XLogP | 3.50 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|