C26H22N2O4 — CID 54125717
benzyl 5-(2-aminophenyl)-2-(1,3-dioxoisoindol-2-yl)pent-4-enoate (PubChem CID 54125717) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is benzyl 5-(2-aminophenyl)-2-(1,3-dioxoisoindol-2-yl)pent-4-enoate.
| Compound Name | benzyl 5-(2-aminophenyl)-2-(1,3-dioxoisoindol-2-yl)pent-4-enoate |
|---|---|
| PubChem CID | 54125717 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | benzyl 5-(2-aminophenyl)-2-(1,3-dioxoisoindol-2-yl)pent-4-enoate |
| SMILES | Nc1ccccc1C=CCC(C(=O)OCc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H22N2O4/c27-22-15-7-4-11-19(22)12-8-16-23(26(31)32-17-18-9-2-1-3-10-18)28-24(29)20-13-5-6-14-21(20)25(28)30/h1-15,23H,16-17,27H2 |
| InChIKey | NQUSOAKNNCOTCF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|