C35H26N2O7 — CID 23314933
[(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxo-4-phenylbutyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 23314933) has the molecular formula C35H26N2O7 and a molecular weight of 586.60 g/mol. Its IUPAC name is [(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxo-4-phenylbutyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
| Compound Name | [(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxo-4-phenylbutyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 23314933 |
| Molecular Formula | C35H26N2O7 |
| Molecular Weight | 586.60 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | [(3S)-3-(1,3-dioxoisoindol-2-yl)-2-oxo-4-phenylbutyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | O=C(OCC(=O)[C@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O)[C@@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C35H26N2O7/c38-30(28(19-22-11-3-1-4-12-22)36-31(39)24-15-7-8-16-25(24)32(36)40)21-44-35(43)29(20-23-13-5-2-6-14-23)37-33(41)26-17-9-10-18-27(26)34(37)42/h1-18,28-29H,19-21H2/t28-,29+/m0/s1 |
| InChIKey | WUWWCNMHAHFCAD-URLMMPGGSA-N |
| XLogP | 3.91 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|