C26H30N2O6Si — CID 23395510
trimethylsilylmethyl 2-(1,3-dioxoisoindol-2-yl)-3-[phenylmethoxycarbonyl(prop-2-enyl)amino]propanoate (PubChem CID 23395510) has the molecular formula C26H30N2O6Si and a molecular weight of 494.62 g/mol. Its IUPAC name is trimethylsilylmethyl 2-(1,3-dioxoisoindol-2-yl)-3-[phenylmethoxycarbonyl(prop-2-enyl)amino]propanoate.
| Compound Name | trimethylsilylmethyl 2-(1,3-dioxoisoindol-2-yl)-3-[phenylmethoxycarbonyl(prop-2-enyl)amino]propanoate |
|---|---|
| PubChem CID | 23395510 |
| Molecular Formula | C26H30N2O6Si |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | trimethylsilylmethyl 2-(1,3-dioxoisoindol-2-yl)-3-[phenylmethoxycarbonyl(prop-2-enyl)amino]propanoate |
| SMILES | C=CCN(CC(C(=O)OC[Si](C)(C)C)N1C(=O)c2ccccc2C1=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H30N2O6Si/c1-5-15-27(26(32)33-17-19-11-7-6-8-12-19)16-22(25(31)34-18-35(2,3)4)28-23(29)20-13-9-10-14-21(20)24(28)30/h5-14,22H,1,15-18H2,2-4H3 |
| InChIKey | VNYCEEFIYUJSOX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|