C19H26N2O6 — CID 10643364
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[phenylmethoxycarbonyl(prop-2-enyl)amino]propanoic acid (PubChem CID 10643364) has the molecular formula C19H26N2O6 and a molecular weight of 378.43 g/mol. Its IUPAC name is (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[phenylmethoxycarbonyl(prop-2-enyl)amino]propanoic acid.
| Compound Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[phenylmethoxycarbonyl(prop-2-enyl)amino]propanoic acid |
|---|---|
| PubChem CID | 10643364 |
| Molecular Formula | C19H26N2O6 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[phenylmethoxycarbonyl(prop-2-enyl)amino]propanoic acid |
| SMILES | C=CCN(C[C@H](NC(=O)OC(C)(C)C)C(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H26N2O6/c1-5-11-21(18(25)26-13-14-9-7-6-8-10-14)12-15(16(22)23)20-17(24)27-19(2,3)4/h5-10,15H,1,11-13H2,2-4H3,(H,20,24)(H,22,23)/t15-/m0/s1 |
| InChIKey | FUCPGSKJDFRXRA-HNNXBMFYSA-N |
| XLogP | 2.79 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|