C16H17F3N2O5 — CID 22854233
(2S)-2-(phenylmethoxycarbonylamino)-3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoic acid (PubChem CID 22854233) has the molecular formula C16H17F3N2O5 and a molecular weight of 374.32 g/mol. Its IUPAC name is (2S)-2-(phenylmethoxycarbonylamino)-3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoic acid.
| Compound Name | (2S)-2-(phenylmethoxycarbonylamino)-3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 22854233 |
| Molecular Formula | C16H17F3N2O5 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | (2S)-2-(phenylmethoxycarbonylamino)-3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoic acid |
| SMILES | C=CCN(C[C@H](NC(=O)OCc1ccccc1)C(=O)O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H17F3N2O5/c1-2-8-21(14(24)16(17,18)19)9-12(13(22)23)20-15(25)26-10-11-6-4-3-5-7-11/h2-7,12H,1,8-10H2,(H,20,25)(H,22,23)/t12-/m0/s1 |
| InChIKey | LONQSQOEGXVMAJ-LBPRGKRZSA-N |
| XLogP | 1.94 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|