C22H30N2O6 — CID 11304649
[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enyl] (2S)-2-(phenylmethoxycarbonylamino)pent-4-enoate (PubChem CID 11304649) has the molecular formula C22H30N2O6 and a molecular weight of 418.49 g/mol. Its IUPAC name is [(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enyl] (2S)-2-(phenylmethoxycarbonylamino)pent-4-enoate.
| Compound Name | [(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enyl] (2S)-2-(phenylmethoxycarbonylamino)pent-4-enoate |
|---|---|
| PubChem CID | 11304649 |
| Molecular Formula | C22H30N2O6 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | [(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enyl] (2S)-2-(phenylmethoxycarbonylamino)pent-4-enoate |
| SMILES | C=CC[C@H](NC(=O)OCc1ccccc1)C(=O)OC[C@@H](C=C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30N2O6/c1-6-11-18(24-20(26)29-14-16-12-9-8-10-13-16)19(25)28-15-17(7-2)23-21(27)30-22(3,4)5/h6-10,12-13,17-18H,1-2,11,14-15H2,3-5H3,(H,23,27)(H,24,26)/t17-,18+/m1/s1 |
| InChIKey | RWRUUTMKHZRJJA-MSOLQXFVSA-N |
| XLogP | 3.48 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|