C21H30N2O4 — CID 167414443
benzyl N-[(2R)-1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]but-3-en-2-yl]carbamate (PubChem CID 167414443) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is benzyl N-[(2R)-1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]but-3-en-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]but-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 167414443 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | benzyl N-[(2R)-1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]but-3-en-2-yl]carbamate |
| SMILES | C=C[C@@H](CC1CC(NC(=O)OC(C)(C)C)C1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H30N2O4/c1-5-17(22-19(24)26-14-15-9-7-6-8-10-15)11-16-12-18(13-16)23-20(25)27-21(2,3)4/h5-10,16-18H,1,11-14H2,2-4H3,(H,22,24)(H,23,25)/t16?,17-,18?/m0/s1 |
| InChIKey | WPIAIOKISSORDK-ADKAHSJRSA-N |
| XLogP | 4.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|