C23H37NO2SSi — CID 102364254
2-(3-sulfanyl-3-tritert-butylsilylpropyl)isoindole-1,3-dione (PubChem CID 102364254) has the molecular formula C23H37NO2SSi and a molecular weight of 419.71 g/mol. Its IUPAC name is 2-(3-sulfanyl-3-tritert-butylsilylpropyl)isoindole-1,3-dione.
| Compound Name | 2-(3-sulfanyl-3-tritert-butylsilylpropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 102364254 |
| Molecular Formula | C23H37NO2SSi |
| Molecular Weight | 419.71 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 2-(3-sulfanyl-3-tritert-butylsilylpropyl)isoindole-1,3-dione |
| SMILES | CC(C)(C)[Si](C(S)CCN1C(=O)c2ccccc2C1=O)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C23H37NO2SSi/c1-21(2,3)28(22(4,5)6,23(7,8)9)18(27)14-15-24-19(25)16-12-10-11-13-17(16)20(24)26/h10-13,18,27H,14-15H2,1-9H3 |
| InChIKey | BMAIHFIBAUUBOF-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.71 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|