C13H15NO5S — CID 138695385
4-(1,3-dioxoisoindol-2-yl)butan-2-yl methanesulfonate (PubChem CID 138695385) has the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)butan-2-yl methanesulfonate.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)butan-2-yl methanesulfonate |
|---|---|
| PubChem CID | 138695385 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)butan-2-yl methanesulfonate |
| SMILES | CC(CCN1C(=O)c2ccccc2C1=O)OS(C)(=O)=O |
| InChI | InChI=1S/C13H15NO5S/c1-9(19-20(2,17)18)7-8-14-12(15)10-5-3-4-6-11(10)13(14)16/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | NNJCMNQQRBWYEK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|