C15H16ClNO4 — CID 133080817
propan-2-yl 2-chloro-4-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 133080817) has the molecular formula C15H16ClNO4 and a molecular weight of 309.75 g/mol. Its IUPAC name is propan-2-yl 2-chloro-4-(1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | propan-2-yl 2-chloro-4-(1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 133080817 |
| Molecular Formula | C15H16ClNO4 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | propan-2-yl 2-chloro-4-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | CC(C)OC(=O)C(Cl)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H16ClNO4/c1-9(2)21-15(20)12(16)7-8-17-13(18)10-5-3-4-6-11(10)14(17)19/h3-6,9,12H,7-8H2,1-2H3 |
| InChIKey | AFMBVTRKOQRPRY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|