C15H15NO4 — CID 615760
propan-2-yl 4-(1,3-dioxoisoindol-2-yl)but-2-enoate (PubChem CID 615760) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is propan-2-yl 4-(1,3-dioxoisoindol-2-yl)but-2-enoate.
| Compound Name | propan-2-yl 4-(1,3-dioxoisoindol-2-yl)but-2-enoate |
|---|---|
| PubChem CID | 615760 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | propan-2-yl 4-(1,3-dioxoisoindol-2-yl)but-2-enoate |
| SMILES | CC(C)OC(=O)C=CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H15NO4/c1-10(2)20-13(17)8-5-9-16-14(18)11-6-3-4-7-12(11)15(16)19/h3-8,10H,9H2,1-2H3 |
| InChIKey | ZSFQRAKPMPPWHW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|