C24H20N2O4 — CID 143563260
2-[(2Z,4E)-4-(1,3-dioxoisoindol-2-yl)hexa-2,4-dienyl]isoindole-1,3-dione;ethene (PubChem CID 143563260) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-[(2Z,4E)-4-(1,3-dioxoisoindol-2-yl)hexa-2,4-dienyl]isoindole-1,3-dione;ethene.
| Compound Name | 2-[(2Z,4E)-4-(1,3-dioxoisoindol-2-yl)hexa-2,4-dienyl]isoindole-1,3-dione;ethene |
|---|---|
| PubChem CID | 143563260 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-[(2Z,4E)-4-(1,3-dioxoisoindol-2-yl)hexa-2,4-dienyl]isoindole-1,3-dione;ethene |
| SMILES | C/C=C(\C=C/CN1C(=O)c2ccccc2C1=O)N1C(=O)c2ccccc2C1=O.C=C |
| InChI | InChI=1S/C22H16N2O4.C2H4/c1-2-14(24-21(27)17-11-5-6-12-18(17)22(24)28)8-7-13-23-19(25)15-9-3-4-10-16(15)20(23)26;1-2/h2-12H,13H2,1H3;1-2H2/b8-7-,14-2+; |
| InChIKey | WJMWZCPVUYMNHE-HUMKBXEMSA-N |
| XLogP | 3.84 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|