C13H11NO2S — CID 143478866
2-[(2E,4Z)-5-sulfanylpenta-2,4-dienyl]isoindole-1,3-dione (PubChem CID 143478866) has the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. Its IUPAC name is 2-[(2E,4Z)-5-sulfanylpenta-2,4-dienyl]isoindole-1,3-dione.
| Compound Name | 2-[(2E,4Z)-5-sulfanylpenta-2,4-dienyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 143478866 |
| Molecular Formula | C13H11NO2S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-[(2E,4Z)-5-sulfanylpenta-2,4-dienyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C/C=C/C=C\S |
| InChI | InChI=1S/C13H11NO2S/c15-12-10-6-2-3-7-11(10)13(16)14(12)8-4-1-5-9-17/h1-7,9,17H,8H2/b4-1+,9-5- |
| InChIKey | LHVDWDNXEMLQMF-YGLQZHNYSA-N |
| XLogP | 2.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|