C17H13NO3 — CID 14395653
2-[(2E,4E)-5-(furan-2-yl)penta-2,4-dienyl]isoindole-1,3-dione (PubChem CID 14395653) has the molecular formula C17H13NO3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-[(2E,4E)-5-(furan-2-yl)penta-2,4-dienyl]isoindole-1,3-dione.
| Compound Name | 2-[(2E,4E)-5-(furan-2-yl)penta-2,4-dienyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 14395653 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-[(2E,4E)-5-(furan-2-yl)penta-2,4-dienyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C/C=C/C=C/c1ccco1 |
| InChI | InChI=1S/C17H13NO3/c19-16-14-9-3-4-10-15(14)17(20)18(16)11-5-1-2-7-13-8-6-12-21-13/h1-10,12H,11H2/b5-1+,7-2+ |
| InChIKey | GHPPORORUKHNBK-OXAVVNGUSA-N |
| XLogP | 3.15 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|