About 2-[5-(furan-2-yl)penta-1,3-dienyl]furan
2-[5-(furan-2-yl)penta-1,3-dienyl]furan (PubChem CID 141170087) has the molecular formula C13H12O2
and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-[5-(furan-2-yl)penta-1,3-dienyl]furan.
Molecular Properties
| Compound Name | 2-[5-(furan-2-yl)penta-1,3-dienyl]furan |
| PubChem CID | 141170087 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 2-[5-(furan-2-yl)penta-1,3-dienyl]furan |
| SMILES | C(C=Cc1ccco1)=CCc1ccco1 |
| InChI | InChI=1S/C13H12O2/c1(2-6-12-8-4-10-14-12)3-7-13-9-5-11-15-13/h1-6,8-11H,7H2 |
| InChIKey | AAUKCYDYGGXBEZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(furan-2-yl)penta-1,3-dienyl]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(furan-2-yl)penta-1,3-dienyl]furan?
The IUPAC name of 2-[5-(furan-2-yl)penta-1,3-dienyl]furan (CID 141170087) is 2-[5-(furan-2-yl)penta-1,3-dienyl]furan.
What is the SMILES notation for 2-[5-(furan-2-yl)penta-1,3-dienyl]furan?
The canonical SMILES for 2-[5-(furan-2-yl)penta-1,3-dienyl]furan is C(C=Cc1ccco1)=CCc1ccco1.
What is the InChIKey of 2-[5-(furan-2-yl)penta-1,3-dienyl]furan?
The InChIKey is AAUKCYDYGGXBEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O2/c1(2-6-12-8-4-10-14-12)3-7-13-9-5-11-15-13/h1-6,8-11H,7H2.
What are the key properties of 2-[5-(furan-2-yl)penta-1,3-dienyl]furan?
2-[5-(furan-2-yl)penta-1,3-dienyl]furan has a molecular weight of 200.24 g/mol, XLogP of 3.68, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(furan-2-yl)penta-1,3-dienyl]furan is sourced from PubChem (CID 141170087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).