About 3-(furan-2-yl)-N,N-dimethylprop-1-en-1-amine
3-(furan-2-yl)-N,N-dimethylprop-1-en-1-amine (PubChem CID 150615164) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 3-(furan-2-yl)-N,N-dimethylprop-1-en-1-amine.
Molecular Properties
| Compound Name | 3-(furan-2-yl)-N,N-dimethylprop-1-en-1-amine |
| PubChem CID | 150615164 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 3-(furan-2-yl)-N,N-dimethylprop-1-en-1-amine |
| SMILES | CN(C)C=CCc1ccco1 |
| InChI | InChI=1S/C9H13NO/c1-10(2)7-3-5-9-6-4-8-11-9/h3-4,6-8H,5H2,1-2H3 |
| InChIKey | IUSPSRZKIUBHKS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(furan-2-yl)-N,N-dimethylprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-2-yl)-N,N-dimethylprop-1-en-1-amine?
The IUPAC name of 3-(furan-2-yl)-N,N-dimethylprop-1-en-1-amine (CID 150615164) is 3-(furan-2-yl)-N,N-dimethylprop-1-en-1-amine.
What is the SMILES notation for 3-(furan-2-yl)-N,N-dimethylprop-1-en-1-amine?
The canonical SMILES for 3-(furan-2-yl)-N,N-dimethylprop-1-en-1-amine is CN(C)C=CCc1ccco1.
What is the InChIKey of 3-(furan-2-yl)-N,N-dimethylprop-1-en-1-amine?
The InChIKey is IUSPSRZKIUBHKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-10(2)7-3-5-9-6-4-8-11-9/h3-4,6-8H,5H2,1-2H3.
What are the key properties of 3-(furan-2-yl)-N,N-dimethylprop-1-en-1-amine?
3-(furan-2-yl)-N,N-dimethylprop-1-en-1-amine has a molecular weight of 151.21 g/mol, XLogP of 1.90, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-yl)-N,N-dimethylprop-1-en-1-amine is sourced from PubChem (CID 150615164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).