C15H19NO2 — CID 142125300
ethane;2-[(E)-pent-2-enyl]isoindole-1,3-dione (PubChem CID 142125300) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is ethane;2-[(E)-pent-2-enyl]isoindole-1,3-dione.
| Compound Name | ethane;2-[(E)-pent-2-enyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 142125300 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | ethane;2-[(E)-pent-2-enyl]isoindole-1,3-dione |
| SMILES | CC.CC/C=C/CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H13NO2.C2H6/c1-2-3-6-9-14-12(15)10-7-4-5-8-11(10)13(14)16;1-2/h3-8H,2,9H2,1H3;1-2H3/b6-3+; |
| InChIKey | GIXRVRRYNSALSC-ZIKNSQGESA-N |
| XLogP | 3.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|