C15H15NO4 — CID 67946768
(Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid (PubChem CID 67946768) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is (Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid.
| Compound Name | (Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid |
|---|---|
| PubChem CID | 67946768 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H15NO4/c17-13(18)9-3-1-2-6-10-16-14(19)11-7-4-5-8-12(11)15(16)20/h2,4-8H,1,3,9-10H2,(H,17,18)/b6-2- |
| InChIKey | LBMMWZAKAGXSFA-KXFIGUGUSA-N |
| XLogP | 2.09 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|