(Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid

C15H15NO4 — CID 67946768

IUPAC(Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid
SMILESO=C(O)CCC/C=C\CN1C(=O)c2ccccc2C1=O
InChIInChI=1S/C15H15NO4/c17-13(18)9-3-1-2-6-10-16-14(19)11-7-4-5-8-12(11)15(16)20/h2,4-8H,1,3,9-10H2,(H,17,18)/b6-2-
InChIKeyLBMMWZAKAGXSFA-KXFIGUGUSA-N
MW273.29 g/mol
LogP2.09
Rot. Bonds6

About (Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid

(Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid (PubChem CID 67946768) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is (Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid.

Molecular Properties

Compound Name(Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid
PubChem CID67946768
Molecular FormulaC15H15NO4
Molecular Weight273.29 g/mol
Exact Mass273.10
IUPAC Name(Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid
SMILESO=C(O)CCC/C=C\CN1C(=O)c2ccccc2C1=O
InChIInChI=1S/C15H15NO4/c17-13(18)9-3-1-2-6-10-16-14(19)11-7-4-5-8-12(11)15(16)20/h2,4-8H,1,3,9-10H2,(H,17,18)/b6-2-
InChIKeyLBMMWZAKAGXSFA-KXFIGUGUSA-N
XLogP2.09
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.29
LogP ≤ 52.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze (Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid?
The IUPAC name of (Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid (CID 67946768) is (Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid.
What is the SMILES notation for (Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid?
The canonical SMILES for (Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid is O=C(O)CCC/C=C\CN1C(=O)c2ccccc2C1=O.
What is the InChIKey of (Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid?
The InChIKey is LBMMWZAKAGXSFA-KXFIGUGUSA-N. The full InChI is InChI=1S/C15H15NO4/c17-13(18)9-3-1-2-6-10-16-14(19)11-7-4-5-8-12(11)15(16)20/h2,4-8H,1,3,9-10H2,(H,17,18)/b6-2-.
What are the key properties of (Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid?
(Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid has a molecular weight of 273.29 g/mol, XLogP of 2.09, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-7-(1,3-dioxoisoindol-2-yl)hept-5-enoic acid is sourced from PubChem (CID 67946768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).