C17H17NO6 — CID 57182197
2-[6-(1,3-dioxoisoindol-2-yl)hexylidene]propanedioic acid (PubChem CID 57182197) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is 2-[6-(1,3-dioxoisoindol-2-yl)hexylidene]propanedioic acid.
| Compound Name | 2-[6-(1,3-dioxoisoindol-2-yl)hexylidene]propanedioic acid |
|---|---|
| PubChem CID | 57182197 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-[6-(1,3-dioxoisoindol-2-yl)hexylidene]propanedioic acid |
| SMILES | O=C(O)C(=CCCCCCN1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C17H17NO6/c19-14-11-7-4-5-8-12(11)15(20)18(14)10-6-2-1-3-9-13(16(21)22)17(23)24/h4-5,7-9H,1-3,6,10H2,(H,21,22)(H,23,24) |
| InChIKey | LCYIQMOVSVFDQK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|