C15H16ClFN2O4 — CID 162258829
(Z)-2-amino-7-(1,3-dioxoisoindol-2-yl)-3-fluorohept-3-enoic acid;hydrochloride (PubChem CID 162258829) has the molecular formula C15H16ClFN2O4 and a molecular weight of 342.75 g/mol. Its IUPAC name is (Z)-2-amino-7-(1,3-dioxoisoindol-2-yl)-3-fluorohept-3-enoic acid;hydrochloride.
| Compound Name | (Z)-2-amino-7-(1,3-dioxoisoindol-2-yl)-3-fluorohept-3-enoic acid;hydrochloride |
|---|---|
| PubChem CID | 162258829 |
| Molecular Formula | C15H16ClFN2O4 |
| Molecular Weight | 342.75 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | (Z)-2-amino-7-(1,3-dioxoisoindol-2-yl)-3-fluorohept-3-enoic acid;hydrochloride |
| SMILES | Cl.NC(C(=O)O)/C(F)=C/CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H15FN2O4.ClH/c16-11(12(17)15(21)22)7-3-4-8-18-13(19)9-5-1-2-6-10(9)14(18)20;/h1-2,5-7,12H,3-4,8,17H2,(H,21,22);1H/b11-7-; |
| InChIKey | ONEZIUADJBQLDL-AJULUCINSA-N |
| XLogP | 1.75 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.75 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|