C16H17FN2O4 — CID 59075845
(Z,2S)-7-(1,3-dioxoisoindol-2-yl)-4-fluoro-2-(methylamino)hept-3-enoic acid (PubChem CID 59075845) has the molecular formula C16H17FN2O4 and a molecular weight of 320.32 g/mol. Its IUPAC name is (Z,2S)-7-(1,3-dioxoisoindol-2-yl)-4-fluoro-2-(methylamino)hept-3-enoic acid.
| Compound Name | (Z,2S)-7-(1,3-dioxoisoindol-2-yl)-4-fluoro-2-(methylamino)hept-3-enoic acid |
|---|---|
| PubChem CID | 59075845 |
| Molecular Formula | C16H17FN2O4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (Z,2S)-7-(1,3-dioxoisoindol-2-yl)-4-fluoro-2-(methylamino)hept-3-enoic acid |
| SMILES | CN[C@@H](/C=C(\F)CCCN1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C16H17FN2O4/c1-18-13(16(22)23)9-10(17)5-4-8-19-14(20)11-6-2-3-7-12(11)15(19)21/h2-3,6-7,9,13,18H,4-5,8H2,1H3,(H,22,23)/b10-9-/t13-/m0/s1 |
| InChIKey | PYDAWTHYNOVAFM-XPSMFNQNSA-N |
| XLogP | 1.59 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|