C23H35N5O4 — CID 14951029
propan-2-yl 4-(1,3-dioxoisoindol-2-yl)-2-(1,4,7,10-tetrazacyclododec-1-yl)butanoate (PubChem CID 14951029) has the molecular formula C23H35N5O4 and a molecular weight of 445.56 g/mol. Its IUPAC name is propan-2-yl 4-(1,3-dioxoisoindol-2-yl)-2-(1,4,7,10-tetrazacyclododec-1-yl)butanoate.
| Compound Name | propan-2-yl 4-(1,3-dioxoisoindol-2-yl)-2-(1,4,7,10-tetrazacyclododec-1-yl)butanoate |
|---|---|
| PubChem CID | 14951029 |
| Molecular Formula | C23H35N5O4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | propan-2-yl 4-(1,3-dioxoisoindol-2-yl)-2-(1,4,7,10-tetrazacyclododec-1-yl)butanoate |
| SMILES | CC(C)OC(=O)C(CCN1C(=O)c2ccccc2C1=O)N1CCNCCNCCNCC1 |
| InChI | InChI=1S/C23H35N5O4/c1-17(2)32-23(31)20(27-15-12-25-10-8-24-9-11-26-13-16-27)7-14-28-21(29)18-5-3-4-6-19(18)22(28)30/h3-6,17,20,24-26H,7-16H2,1-2H3 |
| InChIKey | KZEDDZCIGOXKHC-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|