C26H30N2O4 — CID 10670476
ethyl 2-(4-benzylpiperidin-1-yl)-4-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 10670476) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is ethyl 2-(4-benzylpiperidin-1-yl)-4-(1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | ethyl 2-(4-benzylpiperidin-1-yl)-4-(1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 10670476 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | ethyl 2-(4-benzylpiperidin-1-yl)-4-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | CCOC(=O)C(CCN1C(=O)c2ccccc2C1=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H30N2O4/c1-2-32-26(31)23(14-17-28-24(29)21-10-6-7-11-22(21)25(28)30)27-15-12-20(13-16-27)18-19-8-4-3-5-9-19/h3-11,20,23H,2,12-18H2,1H3 |
| InChIKey | PSXBTIKOIIKOAY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|