C37H42NO5PS — CID 89429070
10-(1,3-dioxoisoindol-2-yl)decyl-triphenylphosphanium;methanesulfonate (PubChem CID 89429070) has the molecular formula C37H42NO5PS and a molecular weight of 643.79 g/mol. Its IUPAC name is 10-(1,3-dioxoisoindol-2-yl)decyl-triphenylphosphanium;methanesulfonate.
| Compound Name | 10-(1,3-dioxoisoindol-2-yl)decyl-triphenylphosphanium;methanesulfonate |
|---|---|
| PubChem CID | 89429070 |
| Molecular Formula | C37H42NO5PS |
| Molecular Weight | 643.79 g/mol |
| Exact Mass | 643.25 |
| IUPAC Name | 10-(1,3-dioxoisoindol-2-yl)decyl-triphenylphosphanium;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].O=C1c2ccccc2C(=O)N1CCCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H39NO2P.CH4O3S/c38-35-33-26-16-17-27-34(33)36(39)37(35)28-18-5-3-1-2-4-6-19-29-40(30-20-10-7-11-21-30,31-22-12-8-13-23-31)32-24-14-9-15-25-32;1-5(2,3)4/h7-17,20-27H,1-6,18-19,28-29H2;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | MZJZIFXREWTUSQ-UHFFFAOYSA-M |
| XLogP | 6.56 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.79 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|