C14H16NNaO5S2 — CID 130234058
sodium 2-(6-oxidosulfonothioyloxyhexyl)isoindole-1,3-dione (PubChem CID 130234058) has the molecular formula C14H16NNaO5S2 and a molecular weight of 365.41 g/mol. Its IUPAC name is sodium 2-(6-oxidosulfonothioyloxyhexyl)isoindole-1,3-dione.
| Compound Name | sodium 2-(6-oxidosulfonothioyloxyhexyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 130234058 |
| Molecular Formula | C14H16NNaO5S2 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | sodium 2-(6-oxidosulfonothioyloxyhexyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCCOS(=O)([O-])=S.[Na+] |
| InChI | InChI=1S/C14H17NO5S2.Na/c16-13-11-7-3-4-8-12(11)14(17)15(13)9-5-1-2-6-10-20-22(18,19)21;/h3-4,7-8H,1-2,5-6,9-10H2,(H,18,19,21);/q;+1/p-1 |
| InChIKey | QIICNSMPZPZDBF-UHFFFAOYSA-M |
| XLogP | -1.34 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|