C12H12NO6S2- — CID 23326213
4-(1,3-dioxoisoindol-2-yl)butylsulfanyl sulfate (PubChem CID 23326213) has the molecular formula C12H12NO6S2- and a molecular weight of 330.36 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)butylsulfanyl sulfate.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)butylsulfanyl sulfate |
|---|---|
| PubChem CID | 23326213 |
| Molecular Formula | C12H12NO6S2- |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)butylsulfanyl sulfate |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCSOS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H13NO6S2/c14-11-9-5-1-2-6-10(9)12(15)13(11)7-3-4-8-20-19-21(16,17)18/h1-2,5-6H,3-4,7-8H2,(H,16,17,18)/p-1 |
| InChIKey | JVYKXXZBCWZZHK-UHFFFAOYSA-M |
| XLogP | 1.19 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|