C16H22NO4PS2 — CID 25131241
2-(4-diethoxyphosphinothioylsulfanylbutyl)isoindole-1,3-dione (PubChem CID 25131241) has the molecular formula C16H22NO4PS2 and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-(4-diethoxyphosphinothioylsulfanylbutyl)isoindole-1,3-dione.
| Compound Name | 2-(4-diethoxyphosphinothioylsulfanylbutyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 25131241 |
| Molecular Formula | C16H22NO4PS2 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 2-(4-diethoxyphosphinothioylsulfanylbutyl)isoindole-1,3-dione |
| SMILES | CCOP(=S)(OCC)SCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H22NO4PS2/c1-3-20-22(23,21-4-2)24-12-8-7-11-17-15(18)13-9-5-6-10-14(13)16(17)19/h5-6,9-10H,3-4,7-8,11-12H2,1-2H3 |
| InChIKey | OOWDOWWXGNTYBT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|