C19H29N2O2+ — CID 26723330
5-(1,3-dioxoisoindol-2-yl)pentyl-triethylazanium (PubChem CID 26723330) has the molecular formula C19H29N2O2+ and a molecular weight of 317.45 g/mol. Its IUPAC name is 5-(1,3-dioxoisoindol-2-yl)pentyl-triethylazanium.
| Compound Name | 5-(1,3-dioxoisoindol-2-yl)pentyl-triethylazanium |
|---|---|
| PubChem CID | 26723330 |
| Molecular Formula | C19H29N2O2+ |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | 5-(1,3-dioxoisoindol-2-yl)pentyl-triethylazanium |
| SMILES | CC[N+](CC)(CC)CCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H29N2O2/c1-4-21(5-2,6-3)15-11-7-10-14-20-18(22)16-12-8-9-13-17(16)19(20)23/h8-9,12-13H,4-7,10-11,14-15H2,1-3H3/q+1 |
| InChIKey | YGWRVPAUJDAOHJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|