C30H40N4O4+2 — CID 10770828
3-(1,3-dioxoisoindol-2-yl)propyl-[4-[3-(1,3-dioxoisoindol-2-yl)propyl-dimethylazaniumyl]butyl]-dimethylazanium (PubChem CID 10770828) has the molecular formula C30H40N4O4+2 and a molecular weight of 520.67 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl-[4-[3-(1,3-dioxoisoindol-2-yl)propyl-dimethylazaniumyl]butyl]-dimethylazanium.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl-[4-[3-(1,3-dioxoisoindol-2-yl)propyl-dimethylazaniumyl]butyl]-dimethylazanium |
|---|---|
| PubChem CID | 10770828 |
| Molecular Formula | C30H40N4O4+2 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl-[4-[3-(1,3-dioxoisoindol-2-yl)propyl-dimethylazaniumyl]butyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCC[N+](C)(C)CCCN1C(=O)c2ccccc2C1=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H40N4O4/c1-33(2,21-11-17-31-27(35)23-13-5-6-14-24(23)28(31)36)19-9-10-20-34(3,4)22-12-18-32-29(37)25-15-7-8-16-26(25)30(32)38/h5-8,13-16H,9-12,17-22H2,1-4H3/q+2 |
| InChIKey | LJNAIFFAZJNTJT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|