C11H11NO5S — CID 3385233
3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonic acid (PubChem CID 3385233) has the molecular formula C11H11NO5S and a molecular weight of 269.28 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonic acid.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 3385233 |
| Molecular Formula | C11H11NO5S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonic acid |
| SMILES | O=C1c2ccccc2C(=O)N1CCCS(=O)(=O)O |
| InChI | InChI=1S/C11H11NO5S/c13-10-8-4-1-2-5-9(8)11(14)12(10)6-3-7-18(15,16)17/h1-2,4-5H,3,6-7H2,(H,15,16,17) |
| InChIKey | DWXBSSQITYVONS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|