C18H20N2O4S — CID 18799331
4-(5-methyl-6-oxobenzo[b][1,4]benzodiazepin-11-yl)butane-1-sulfonic acid (PubChem CID 18799331) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 4-(5-methyl-6-oxobenzo[b][1,4]benzodiazepin-11-yl)butane-1-sulfonic acid.
| Compound Name | 4-(5-methyl-6-oxobenzo[b][1,4]benzodiazepin-11-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 18799331 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 4-(5-methyl-6-oxobenzo[b][1,4]benzodiazepin-11-yl)butane-1-sulfonic acid |
| SMILES | CN1C(=O)c2ccccc2N(CCCCS(=O)(=O)O)c2ccccc21 |
| InChI | InChI=1S/C18H20N2O4S/c1-19-16-10-4-5-11-17(16)20(12-6-7-13-25(22,23)24)15-9-3-2-8-14(15)18(19)21/h2-5,8-11H,6-7,12-13H2,1H3,(H,22,23,24) |
| InChIKey | QELSVEGNNSMIKE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|