C23H26ClN3O3 — CID 155733718
ethyl (E)-4-[3-(2-chloro-5-methyl-6-oxobenzo[b][1,4]benzodiazepin-11-yl)propylamino]but-2-enoate (PubChem CID 155733718) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is ethyl (E)-4-[3-(2-chloro-5-methyl-6-oxobenzo[b][1,4]benzodiazepin-11-yl)propylamino]but-2-enoate.
| Compound Name | ethyl (E)-4-[3-(2-chloro-5-methyl-6-oxobenzo[b][1,4]benzodiazepin-11-yl)propylamino]but-2-enoate |
|---|---|
| PubChem CID | 155733718 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | ethyl (E)-4-[3-(2-chloro-5-methyl-6-oxobenzo[b][1,4]benzodiazepin-11-yl)propylamino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CNCCCN1c2ccccc2C(=O)N(C)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C23H26ClN3O3/c1-3-30-22(28)10-6-13-25-14-7-15-27-19-9-5-4-8-18(19)23(29)26(2)20-12-11-17(24)16-21(20)27/h4-6,8-12,16,25H,3,7,13-15H2,1-2H3/b10-6+ |
| InChIKey | XFEZFJMGNAXLRL-UXBLZVDNSA-N |
| XLogP | 4.17 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|