C28H31ClN2O7 — CID 175812182
(Z)-but-2-enedioic acid;ethyl (E)-4-[[4-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-4-oxobutyl]amino]but-2-enoate (PubChem CID 175812182) has the molecular formula C28H31ClN2O7 and a molecular weight of 543.02 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;ethyl (E)-4-[[4-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-4-oxobutyl]amino]but-2-enoate.
| Compound Name | (Z)-but-2-enedioic acid;ethyl (E)-4-[[4-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-4-oxobutyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 175812182 |
| Molecular Formula | C28H31ClN2O7 |
| Molecular Weight | 543.02 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | (Z)-but-2-enedioic acid;ethyl (E)-4-[[4-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-4-oxobutyl]amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CNCCCC(=O)N1c2ccccc2CCc2ccc(Cl)cc21.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C24H27ClN2O3.C4H4O4/c1-2-30-24(29)10-6-16-26-15-5-9-23(28)27-21-8-4-3-7-18(21)11-12-19-13-14-20(25)17-22(19)27;5-3(6)1-2-4(7)8/h3-4,6-8,10,13-14,17,26H,2,5,9,11-12,15-16H2,1H3;1-2H,(H,5,6)(H,7,8)/b10-6+;2-1- |
| InChIKey | HDUMGWMGTQIFBN-OCAIAXJTSA-N |
| XLogP | 4.30 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.02 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|