C21H27ClN4O2 — CID 166010102
ethyl (E)-4-[3-(8-chloro-1-methyl-4,5-dihydropyrazolo[5,4-b][1]benzazepin-10-yl)propylamino]but-2-enoate (PubChem CID 166010102) has the molecular formula C21H27ClN4O2 and a molecular weight of 402.93 g/mol. Its IUPAC name is ethyl (E)-4-[3-(8-chloro-1-methyl-4,5-dihydropyrazolo[5,4-b][1]benzazepin-10-yl)propylamino]but-2-enoate.
| Compound Name | ethyl (E)-4-[3-(8-chloro-1-methyl-4,5-dihydropyrazolo[5,4-b][1]benzazepin-10-yl)propylamino]but-2-enoate |
|---|---|
| PubChem CID | 166010102 |
| Molecular Formula | C21H27ClN4O2 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | ethyl (E)-4-[3-(8-chloro-1-methyl-4,5-dihydropyrazolo[5,4-b][1]benzazepin-10-yl)propylamino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CNCCCN1c2cc(Cl)ccc2CCc2cnn(C)c21 |
| InChI | InChI=1S/C21H27ClN4O2/c1-3-28-20(27)6-4-11-23-12-5-13-26-19-14-18(22)10-9-16(19)7-8-17-15-24-25(2)21(17)26/h4,6,9-10,14-15,23H,3,5,7-8,11-13H2,1-2H3/b6-4+ |
| InChIKey | DALZEKNSSQXISH-GQCTYLIASA-N |
| XLogP | 3.41 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|