C22H29ClN4O2 — CID 155383172
ethyl (E)-4-[4-(8-chloro-1-methyl-4,5-dihydropyrazolo[5,4-b][1]benzazepin-10-yl)butylamino]but-2-enoate (PubChem CID 155383172) has the molecular formula C22H29ClN4O2 and a molecular weight of 416.95 g/mol. Its IUPAC name is ethyl (E)-4-[4-(8-chloro-1-methyl-4,5-dihydropyrazolo[5,4-b][1]benzazepin-10-yl)butylamino]but-2-enoate.
| Compound Name | ethyl (E)-4-[4-(8-chloro-1-methyl-4,5-dihydropyrazolo[5,4-b][1]benzazepin-10-yl)butylamino]but-2-enoate |
|---|---|
| PubChem CID | 155383172 |
| Molecular Formula | C22H29ClN4O2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | ethyl (E)-4-[4-(8-chloro-1-methyl-4,5-dihydropyrazolo[5,4-b][1]benzazepin-10-yl)butylamino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CNCCCCN1c2cc(Cl)ccc2CCc2cnn(C)c21 |
| InChI | InChI=1S/C22H29ClN4O2/c1-3-29-21(28)7-6-13-24-12-4-5-14-27-20-15-19(23)11-10-17(20)8-9-18-16-25-26(2)22(18)27/h6-7,10-11,15-16,24H,3-5,8-9,12-14H2,1-2H3/b7-6+ |
| InChIKey | RVYDKDUETAIVLN-VOTSOKGWSA-N |
| XLogP | 3.80 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|