C23H25ClN2O3 — CID 167649679
ethyl (E)-4-[3-(2-chloro-5-oxo-6H-benzo[b][1]benzazepin-11-yl)propylamino]but-2-enoate (PubChem CID 167649679) has the molecular formula C23H25ClN2O3 and a molecular weight of 412.92 g/mol. Its IUPAC name is ethyl (E)-4-[3-(2-chloro-5-oxo-6H-benzo[b][1]benzazepin-11-yl)propylamino]but-2-enoate.
| Compound Name | ethyl (E)-4-[3-(2-chloro-5-oxo-6H-benzo[b][1]benzazepin-11-yl)propylamino]but-2-enoate |
|---|---|
| PubChem CID | 167649679 |
| Molecular Formula | C23H25ClN2O3 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | ethyl (E)-4-[3-(2-chloro-5-oxo-6H-benzo[b][1]benzazepin-11-yl)propylamino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CNCCCN1c2ccccc2CC(=O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C23H25ClN2O3/c1-2-29-23(28)9-5-12-25-13-6-14-26-20-8-4-3-7-17(20)15-22(27)19-11-10-18(24)16-21(19)26/h3-5,7-11,16,25H,2,6,12-15H2,1H3/b9-5+ |
| InChIKey | KLIBOKUWSJXODU-WEVVVXLNSA-N |
| XLogP | 4.32 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|