C29H39ClN2O5 — CID 155383171
ethyl (E)-4-[4-[9-chloro-3-[2-(2-methoxyethoxy)ethoxy]-5,6-dihydrobenzo[b][1]benzazepin-11-yl]butylamino]but-2-enoate (PubChem CID 155383171) has the molecular formula C29H39ClN2O5 and a molecular weight of 531.09 g/mol. Its IUPAC name is ethyl (E)-4-[4-[9-chloro-3-[2-(2-methoxyethoxy)ethoxy]-5,6-dihydrobenzo[b][1]benzazepin-11-yl]butylamino]but-2-enoate.
| Compound Name | ethyl (E)-4-[4-[9-chloro-3-[2-(2-methoxyethoxy)ethoxy]-5,6-dihydrobenzo[b][1]benzazepin-11-yl]butylamino]but-2-enoate |
|---|---|
| PubChem CID | 155383171 |
| Molecular Formula | C29H39ClN2O5 |
| Molecular Weight | 531.09 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | ethyl (E)-4-[4-[9-chloro-3-[2-(2-methoxyethoxy)ethoxy]-5,6-dihydrobenzo[b][1]benzazepin-11-yl]butylamino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CNCCCCN1c2ccc(OCCOCCOC)cc2CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C29H39ClN2O5/c1-3-36-29(33)7-6-15-31-14-4-5-16-32-27-13-12-26(37-20-19-35-18-17-34-2)21-24(27)9-8-23-10-11-25(30)22-28(23)32/h6-7,10-13,21-22,31H,3-5,8-9,14-20H2,1-2H3/b7-6+ |
| InChIKey | SBNMHZPCDCLOIS-VOTSOKGWSA-N |
| XLogP | 5.11 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.09 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|