C23H27ClN2O3 — CID 155367461
(E)-4-[4-[9-chloro-3-(hydroxymethyl)-5,6-dihydrobenzo[b][1]benzazepin-11-yl]butylamino]but-2-enoic acid (PubChem CID 155367461) has the molecular formula C23H27ClN2O3 and a molecular weight of 414.93 g/mol. Its IUPAC name is (E)-4-[4-[9-chloro-3-(hydroxymethyl)-5,6-dihydrobenzo[b][1]benzazepin-11-yl]butylamino]but-2-enoic acid.
| Compound Name | (E)-4-[4-[9-chloro-3-(hydroxymethyl)-5,6-dihydrobenzo[b][1]benzazepin-11-yl]butylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 155367461 |
| Molecular Formula | C23H27ClN2O3 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (E)-4-[4-[9-chloro-3-(hydroxymethyl)-5,6-dihydrobenzo[b][1]benzazepin-11-yl]butylamino]but-2-enoic acid |
| SMILES | O=C(O)/C=C/CNCCCCN1c2ccc(CO)cc2CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C23H27ClN2O3/c24-20-9-8-18-6-7-19-14-17(16-27)5-10-21(19)26(22(18)15-20)13-2-1-11-25-12-3-4-23(28)29/h3-5,8-10,14-15,25,27H,1-2,6-7,11-13,16H2,(H,28,29)/b4-3+ |
| InChIKey | MDCJPAMNNYRXSW-ONEGZZNKSA-N |
| XLogP | 4.08 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|