C29H35ClN2O7 — CID 167636124
ethyl (E)-4-[4-(9-chloro-3-methoxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butylamino]but-2-enoate;[(Z)-2-formyloxyethenyl] formate (PubChem CID 167636124) has the molecular formula C29H35ClN2O7 and a molecular weight of 559.06 g/mol. Its IUPAC name is ethyl (E)-4-[4-(9-chloro-3-methoxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butylamino]but-2-enoate;[(Z)-2-formyloxyethenyl] formate.
| Compound Name | ethyl (E)-4-[4-(9-chloro-3-methoxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butylamino]but-2-enoate;[(Z)-2-formyloxyethenyl] formate |
|---|---|
| PubChem CID | 167636124 |
| Molecular Formula | C29H35ClN2O7 |
| Molecular Weight | 559.06 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | ethyl (E)-4-[4-(9-chloro-3-methoxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butylamino]but-2-enoate;[(Z)-2-formyloxyethenyl] formate |
| SMILES | CCOC(=O)/C=C/CNCCCCN1c2ccc(OC)cc2CCc2ccc(Cl)cc21.O=CO/C=C\OC=O |
| InChI | InChI=1S/C25H31ClN2O3.C4H4O4/c1-3-31-25(29)7-6-15-27-14-4-5-16-28-23-13-12-22(30-2)17-20(23)9-8-19-10-11-21(26)18-24(19)28;5-3-7-1-2-8-4-6/h6-7,10-13,17-18,27H,3-5,8-9,14-16H2,1-2H3;1-4H/b7-6+;2-1- |
| InChIKey | OMPAIOCXHXIPQM-GVTSEVKNSA-N |
| XLogP | 4.88 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.06 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|