C29H34ClN3O8 — CID 167585952
ethyl (E)-4-[4-[9-chloro-5-(2-hydroxyethyl)-6-oxobenzo[b][1,4]benzodiazepin-11-yl]butylamino]but-2-enoate;(Z)-3-formyloxyprop-2-enoic acid (PubChem CID 167585952) has the molecular formula C29H34ClN3O8 and a molecular weight of 588.06 g/mol. Its IUPAC name is ethyl (E)-4-[4-[9-chloro-5-(2-hydroxyethyl)-6-oxobenzo[b][1,4]benzodiazepin-11-yl]butylamino]but-2-enoate;(Z)-3-formyloxyprop-2-enoic acid.
| Compound Name | ethyl (E)-4-[4-[9-chloro-5-(2-hydroxyethyl)-6-oxobenzo[b][1,4]benzodiazepin-11-yl]butylamino]but-2-enoate;(Z)-3-formyloxyprop-2-enoic acid |
|---|---|
| PubChem CID | 167585952 |
| Molecular Formula | C29H34ClN3O8 |
| Molecular Weight | 588.06 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | ethyl (E)-4-[4-[9-chloro-5-(2-hydroxyethyl)-6-oxobenzo[b][1,4]benzodiazepin-11-yl]butylamino]but-2-enoate;(Z)-3-formyloxyprop-2-enoic acid |
| SMILES | CCOC(=O)/C=C/CNCCCCN1c2cc(Cl)ccc2C(=O)N(CCO)c2ccccc21.O=CO/C=C\C(=O)O |
| InChI | InChI=1S/C25H30ClN3O4.C4H4O4/c1-2-33-24(31)10-7-14-27-13-5-6-15-28-21-8-3-4-9-22(21)29(16-17-30)25(32)20-12-11-19(26)18-23(20)28;5-3-8-2-1-4(6)7/h3-4,7-12,18,27,30H,2,5-6,13-17H2,1H3;1-3H,(H,6,7)/b10-7+;2-1- |
| InChIKey | HUNHMRGMLOZJLJ-IWHATJSRSA-N |
| XLogP | 3.68 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.06 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|