C28H37ClN2O4 — CID 155733727
ethyl (E)-4-[4-[2-chloro-7-(2-methoxyethoxymethyl)-5,6-dihydrobenzo[b][1]benzazepin-11-yl]butylamino]but-2-enoate (PubChem CID 155733727) has the molecular formula C28H37ClN2O4 and a molecular weight of 501.07 g/mol. Its IUPAC name is ethyl (E)-4-[4-[2-chloro-7-(2-methoxyethoxymethyl)-5,6-dihydrobenzo[b][1]benzazepin-11-yl]butylamino]but-2-enoate.
| Compound Name | ethyl (E)-4-[4-[2-chloro-7-(2-methoxyethoxymethyl)-5,6-dihydrobenzo[b][1]benzazepin-11-yl]butylamino]but-2-enoate |
|---|---|
| PubChem CID | 155733727 |
| Molecular Formula | C28H37ClN2O4 |
| Molecular Weight | 501.07 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | ethyl (E)-4-[4-[2-chloro-7-(2-methoxyethoxymethyl)-5,6-dihydrobenzo[b][1]benzazepin-11-yl]butylamino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CNCCCCN1c2cc(Cl)ccc2CCc2c(COCCOC)cccc21 |
| InChI | InChI=1S/C28H37ClN2O4/c1-3-35-28(32)10-7-16-30-15-4-5-17-31-26-9-6-8-23(21-34-19-18-33-2)25(26)14-12-22-11-13-24(29)20-27(22)31/h6-11,13,20,30H,3-5,12,14-19,21H2,1-2H3/b10-7+ |
| InChIKey | NSBFGJMTSZUHBC-JXMROGBWSA-N |
| XLogP | 5.23 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.07 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|